CymitQuimica logo

CAS 36131-47-2

:

Ethyl 5-formyl-4-nitro-1H-pyrrole-2-carboxylate

Description:
Ethyl 5-formyl-4-nitro-1H-pyrrole-2-carboxylate, with the CAS number 36131-47-2, is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a formyl group (-CHO) and a nitro group (-NO2) attached to the pyrrole ring, contributing to its reactivity and potential applications in organic synthesis. The ethyl ester functional group (-COOEt) enhances its solubility in organic solvents, making it useful in various chemical reactions. The presence of both electron-withdrawing groups (the nitro and formyl groups) and an electron-donating group (the ethyl ester) can influence its electronic properties, making it a candidate for studies in medicinal chemistry and materials science. Additionally, the compound may exhibit interesting biological activities due to its structural features, which can be explored for potential pharmaceutical applications. Overall, its unique combination of functional groups and structural characteristics makes it a valuable compound in synthetic organic chemistry.
Formula:C8H8N2O5
InChI:InChI=1S/C8H8N2O5/c1-2-15-8(12)5-3-7(10(13)14)6(4-11)9-5/h3-4,9H,2H2,1H3
InChI key:InChIKey=OVEMXJXDWGFRTN-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=O)NC(C(OCC)=O)=C1
Synonyms:
  • Ethyl 5-formyl-4-nitro-1H-pyrrole-2-carboxylate
  • 1H-Pyrrole-2-carboxylic acid, 5-formyl-4-nitro-, ethyl ester
  • Ethyl 5-formyl-4-nitropyrrole-2-carboxylate
  • Ethyl 5-formyl-4-nitropyrrole-2-carboxylate（WS201650）
Found 1 products.