CAS 36204-23-6
:fibrinopeptide B human
Description:
Fibrinopeptide B (human) is a peptide fragment derived from the cleavage of fibrinogen during the coagulation process. It plays a crucial role in blood clot formation, as it is released when fibrinogen is converted to fibrin by the enzyme thrombin. The peptide is composed of a specific sequence of amino acids, which contributes to its biological function in hemostasis. Fibrinopeptide B is typically found in the bloodstream and serves as a marker for thrombin activity, making it significant in clinical diagnostics related to coagulation disorders. Its presence can indicate various pathological conditions, including thrombosis and disseminated intravascular coagulation (DIC). The CAS number 36204-23-6 uniquely identifies this substance in chemical databases, facilitating research and regulatory processes. Overall, fibrinopeptide B is essential for understanding the dynamics of blood coagulation and the physiological responses to vascular injury.
Formula:C66H93N19O25
InChI:InChI=1/C66H93N19O25/c1-31(2)53(85-49(91)29-73-55(99)35-16-19-47(89)75-35)64(108)83-42(26-46(68)88)61(105)82-43(27-52(96)97)62(106)81-41(25-45(67)87)60(104)78-37(18-21-51(94)95)57(101)77-36(17-20-50(92)93)56(100)72-28-48(90)76-39(23-33-11-6-4-7-12-33)58(102)80-40(24-34-13-8-5-9-14-34)59(103)84-44(30-86)63(107)74-32(3)54(98)79-38(65(109)110)15-10-22-71-66(69)70/h4-9,11-14,31-32,35-44,53,86H,10,15-30H2,1-3H3,(H2,67,87)(H2,68,88)(H,72,100)(H,73,99)(H,74,107)(H,75,89)(H,76,90)(H,77,101)(H,78,104)(H,79,98)(H,80,102)(H,81,106)(H,82,105)(H,83,108)(H,84,103)(H,85,91)(H,92,93)(H,94,95)(H,96,97)(H,109,110)(H4,69,70,71)/t32-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,53-/m0/s1
SMILES:CC(C)[C@@H](C(=N[C@@H](CC(=N)O)C(=N[C@@H](CC(=O)O)C(=N[C@@H](CC(=N)O)C(=N[C@@H](CCC(=O)O)C(=N[C@@H](CCC(=O)O)C(=NCC(=N[C@@H](Cc1ccccc1)C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CO)C(=N[C@@H](C)C(=N[C@@H](CCCNC(=N)N)C(=O)O)O)O)O)O)O)O)O)O)O)O)O)N=C(CN=C([C@@H]1CCC(=N1)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Fibrinopeptide B, Human
CAS:For cellular and molecular biology applicationsColor and Shape:White, Lyophilized powderFibrinopeptide B, human
CAS:Fibrinopeptide B (FPB) is produced during the cleavage of fibrinogen, by thrombin, to fibrin monomer.Formula:C66H93N19O25Purity:98%Color and Shape:SolidMolecular weight:1552.56Fibrinopeptide B (human) trifluoroacetate salt
CAS:Fibrinopeptide B is a fibrinogen-derived peptide that has shown to inhibit the growth of HL-60 cells. It may be active as a receptor antagonist for thrombin and caproic acid. Fibrinopeptide B also inhibits angiogenesis by inhibiting the binding of acidic, basic proteins to the vascular endothelium in atherosclerotic lesions. The biological sample can be obtained from human serum or plasma.Formula:C66H93N19O25Purity:Min. 95%Molecular weight:1,552.56 g/mol



