CAS 36204-23-6

fibrinopeptide B human

Description:

Fibrinopeptide B (human) is a peptide fragment derived from the cleavage of fibrinogen during the coagulation process. It plays a crucial role in blood clot formation, as it is released when fibrinogen is converted to fibrin by the enzyme thrombin. The peptide is composed of a specific sequence of amino acids, which contributes to its biological function in hemostasis. Fibrinopeptide B is typically found in the bloodstream and serves as a marker for thrombin activity, making it significant in clinical diagnostics related to coagulation disorders. Its presence can indicate various pathological conditions, including thrombosis and disseminated intravascular coagulation (DIC). The CAS number 36204-23-6 uniquely identifies this substance in chemical databases, facilitating research and regulatory processes. Overall, fibrinopeptide B is essential for understanding the dynamics of blood coagulation and the physiological responses to vascular injury.

Formula: C₆₆H₉₃N₁₉O₂₅

InChI: InChI=1/C66H93N19O25/c1-31(2)53(85-49(91)29-73-55(99)35-16-19-47(89)75-35)64(108)83-42(26-46(68)88)61(105)82-43(27-52(96)97)62(106)81-41(25-45(67)87)60(104)78-37(18-21-51(94)95)57(101)77-36(17-20-50(92)93)56(100)72-28-48(90)76-39(23-33-11-6-4-7-12-33)58(102)80-40(24-34-13-8-5-9-14-34)59(103)84-44(30-86)63(107)74-32(3)54(98)79-38(65(109)110)15-10-22-71-66(69)70/h4-9,11-14,31-32,35-44,53,86H,10,15-30H2,1-3H3,(H2,67,87)(H2,68,88)(H,72,100)(H,73,99)(H,74,107)(H,75,89)(H,76,90)(H,77,101)(H,78,104)(H,79,98)(H,80,102)(H,81,106)(H,82,105)(H,83,108)(H,84,103)(H,85,91)(H,92,93)(H,94,95)(H,96,97)(H,109,110)(H4,69,70,71)/t32-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,53-/m0/s1

SMILES: CC(C)[C@@H](C(=N[C@@H](CC(=N)O)C(=N[C@@H](CC(=O)O)C(=N[C@@H](CC(=N)O)C(=N[C@@H](CCC(=O)O)C(=N[C@@H](CCC(=O)O)C(=NCC(=N[C@@H](Cc1ccccc1)C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CO)C(=N[C@@H](C)C(=N[C@@H](CCCNC(=N)N)C(=O)O)O)O)O)O)O)O)O)O)O)O)O)N=C(CN=C([C@@H]1CCC(=N1)O)O)O

Fibrinopeptide B, Human

CAS: 36204-23-6

For cellular and molecular biology applications

Color and Shape: White, Lyophilized powder

Ref: 02-J66812

Fibrinopeptide B, human

CAS: 36204-23-6

Fibrinopeptide B (FPB) is produced during the cleavage of fibrinogen, by thrombin, to fibrin monomer.

Formula: C₆₆H₉₃N₁₉O₂₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 1552.56

Ref: TM-TP1163

Fibrinopeptide B (human) trifluoroacetate salt

CAS: 36204-23-6

Fibrinopeptide B is a fibrinogen-derived peptide that has shown to inhibit the growth of HL-60 cells. It may be active as a receptor antagonist for thrombin and caproic acid. Fibrinopeptide B also inhibits angiogenesis by inhibiting the binding of acidic, basic proteins to the vascular endothelium in atherosclerotic lesions. The biological sample can be obtained from human serum or plasma.

Formula: C₆₆H₉₃N₁₉O₂₅

Purity: Min. 95%

Molecular weight: 1,552.56 g/mol

Ref: 3D-FF108817