CymitQuimica logo

CAS 362049-54-5

:

Sulfonium,[(3S)-3-amino-3-carboxypropyl]di(methyl-d3)-, chloride (9CI)

Description:
Sulfonium, [(3S)-3-amino-3-carboxypropyl]di(methyl-d3)-, chloride is a quaternary ammonium compound characterized by the presence of a sulfonium ion, which is a positively charged sulfur atom bonded to three organic groups. In this case, the compound features a chiral center at the 3-position of a propyl chain, which is substituted with both an amino group and a carboxylic acid group, contributing to its biological activity and potential applications in pharmaceuticals. The di(methyl-d3) designation indicates that the methyl groups attached to the sulfur atom are deuterated, which can be useful in studies involving isotopic labeling. The chloride ion serves as the counterion, balancing the positive charge of the sulfonium ion. This compound may exhibit properties such as solubility in polar solvents and potential reactivity in various chemical environments, making it of interest in organic synthesis and medicinal chemistry. Its specific applications and behavior would depend on the context of its use, particularly in biological systems or as a reagent in chemical reactions.
Formula:C6H8D6NO2SCl
InChI:InChI=1S/C6H13NO2S.ClH/c1-10(2)4-3-5(7)6(8)9;/h5H,3-4,7H2,1-2H3;1H/t5-;/m0./s1/i1D3,2D3;
InChI key:MYGVPKMVGSXPCQ-YIUVPUIYSA-N
SMILES:[2H]C([2H])([2H])[S+](CC[C@@H](C(=O)O)N)C([2H])([2H])[2H].[Cl-]
Synonyms:
  • L-Methionine-D3 (S-Methyl-D3)-Methyl-D3 Sulfonium Chloride
  • L-Methionine-D3-Methyl-D3-Sulfonium Chloride
Found 4 products.