CAS 362049-59-0

L-Leucine-3,3-d2 (9CI)

Description:

L-Leucine-3,3-d2 (9CI) is a deuterated form of the essential amino acid L-leucine, which is crucial for protein synthesis and various metabolic processes in the body. The "3,3-d2" designation indicates that two hydrogen atoms at the 3-position of the leucine side chain have been replaced with deuterium, a stable isotope of hydrogen. This modification is often used in research and analytical applications, particularly in studies involving metabolic pathways and protein dynamics, as deuterated compounds can provide insights into molecular behavior through techniques like NMR spectroscopy. L-Leucine itself is characterized by its hydrophobic nature, contributing to its role in protein structure and function. It is also involved in stimulating muscle protein synthesis and regulating blood sugar levels. The CAS number 362049-59-0 uniquely identifies this specific isotopologue, facilitating its use in scientific literature and databases. Overall, L-Leucine-3,3-d2 serves as a valuable tool in biochemical research, allowing for enhanced tracking and analysis of metabolic processes.

Formula: C₆H₁₁D₂NO₂

InChI: InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i3D2

InChI key: ROHFNLRQFUQHCH-YVKXTFNSSA-N

SMILES: [2H]C([2H])([C@@H](C(=O)O)N)C(C)C

Synonyms:

• L-Leucine-3,3-D2

L-Leucine-d2

CAS: 362049-59-0

L-Leucine-d2

Formula: C₆H₁₁D₂NO₂

Purity: 99%

Molecular weight: 133.19

Ref: 54-DE2610

L-Leucine-D2

CAS: 362049-59-0

L-Leucine-D2 is the deuterated form of L-Leucine. L-Leucine (T3O2749) is an essential branched-chain amino acid (BCAA) that activates the mTOR signaling pathway.

Formula: C₆H₁₃NO₂

Molecular weight: 133.19

Ref: TM-TMID-1245

L-Leucine-3,3-d2

CAS: 362049-59-0, 61-90-5

Formula: (CH₃)₂CHCD₂CH(NH₂)COOH

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 133.10718

Ref: 3U-D5482

L-Leucine-3,3-d2

Controlled Product

CAS: 362049-59-0

Applications L-Leucine-3,3-d2 (CAS# 362049-59-0) is a useful isotopically labeled research compound.

Formula: C₆D₂H₁₁NO₂

Color and Shape: Neat

Molecular weight: 133.1852

Ref: TR-L330111

L-Leucine-3,3-d2

CAS: 362049-59-0

Formula: C₆H₁₃NO₂

Molecular weight: 133.19

Ref: BE-MD-4415D2