CymitQuimica logo

CAS 3622-04-6

:

1,3-Benzothiazole-2-carboxylic acid

Description:
1,3-Benzothiazole-2-carboxylic acid is an organic compound characterized by its bicyclic structure, which includes a benzene ring fused to a thiazole ring. This compound features a carboxylic acid functional group (-COOH) at the 2-position of the thiazole ring, contributing to its acidic properties. It is typically a white to off-white solid that is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The compound exhibits various chemical reactivity due to the presence of both the carboxylic acid and the thiazole moiety, making it useful in synthetic organic chemistry and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, 1,3-benzothiazole derivatives are known for their biological activities, including antimicrobial and antifungal properties. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper safety measures should be observed when working with this substance in a laboratory setting.
Formula:C8H5NO2S
InChI:InChI=1/C8H5NO2S/c10-8(11)7-9-5-3-1-2-4-6(5)12-7/h1-4H,(H,10,11)
InChI key:UUVDQMYRPUHXPB-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)nc(C(=O)O)s2
Synonyms:
  • Benzo[D]Thiazole-2-Carboxylic Acid
Found 4 products.