CAS 3625-85-2
:(S)-Tiopronin
Description:
(S)-Tiopronin, with the CAS number 3625-85-2, is a thiol-containing compound primarily used as a pharmaceutical agent. It is a chiral molecule, existing in the S-enantiomeric form, which is significant for its biological activity. Tiopronin acts as a cysteine donor and is known for its ability to form mixed disulfides, which can facilitate the excretion of heavy metals and other toxic substances from the body. The compound is characterized by its solubility in water and its stability under physiological conditions. It is often utilized in the treatment of conditions such as cystinuria, where it helps to prevent the formation of cystine stones in the kidneys. Additionally, (S)-Tiopronin has antioxidant properties, contributing to its therapeutic effects. Its mechanism of action involves the modulation of thiol levels in the body, which plays a crucial role in various biochemical processes. Overall, (S)-Tiopronin is an important compound in medicinal chemistry, particularly in the context of detoxification and metabolic disorders.
Formula:C5H9NO3S
InChI:InChI=1S/C5H9NO3S/c1-3(10)5(9)6-2-4(7)8/h3,10H,2H2,1H3,(H,6,9)(H,7,8)/t3-/m0/s1
InChI key:InChIKey=YTGJWQPHMWSCST-VKHMYHEASA-N
SMILES:C(NCC(O)=O)([C@H](C)S)=O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
