CymitQuimica logo

CAS 362669-41-8

:

ethyl 8-(4-methoxyphenyl)-8-oxooctanoate

Description:
Ethyl 8-(4-methoxyphenyl)-8-oxooctanoate, identified by its CAS number 362669-41-8, is an organic compound characterized by its ester functional group and a complex structure that includes a methoxy-substituted phenyl group. This compound typically exhibits a moderate to high molecular weight and is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic alkyl chain. Ethyl 8-(4-methoxyphenyl)-8-oxooctanoate may possess biological activity, making it of interest in pharmaceutical and chemical research. Its structure suggests potential applications in drug development, particularly in the synthesis of compounds with therapeutic properties. As with many organic compounds, it is essential to handle this substance with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C17H24O4
InChI:InChI=1/C17H24O4/c1-3-21-17(19)9-7-5-4-6-8-16(18)14-10-12-15(20-2)13-11-14/h10-13H,3-9H2,1-2H3
SMILES:CCOC(=O)CCCCCCC(=O)c1ccc(cc1)OC
Found 1 products.