CymitQuimica logo

CAS 362670-06-2

:

tert-butyl N-(5-fluoro-2-nitro-phenyl)carbamate

Description:
Tert-butyl N-(5-fluoro-2-nitro-phenyl)carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of an amine with a carbonic acid derivative. This compound features a tert-butyl group, providing steric hindrance and enhancing its lipophilicity, which can influence its solubility and biological activity. The presence of a 5-fluoro-2-nitrophenyl moiety introduces both electron-withdrawing and electron-donating characteristics, affecting the compound's reactivity and potential interactions in biological systems. The nitro group is known for its ability to participate in various chemical reactions, including reduction processes. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if not managed properly.
Formula:C11H13FN2O4
InChI:InChI=1/C11H13FN2O4/c1-11(2,3)18-10(15)13-8-6-7(12)4-5-9(8)14(16)17/h4-6H,1-3H3,(H,13,15)
InChI key:KQXLDRFQXVVIJB-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=Nc1cc(ccc1N(=O)=O)F)O
Found 4 products.