CymitQuimica logo

CAS 363-69-9

:

Benzene, 2,4-dibromo-1,3,5-trifluoro-

Description:
Benzene, 2,4-dibromo-1,3,5-trifluoro- (CAS 363-69-9) is a halogenated aromatic compound characterized by the presence of both bromine and fluorine substituents on a benzene ring. Specifically, it features two bromine atoms located at the 2 and 4 positions, and three fluorine atoms at the 1, 3, and 5 positions of the benzene ring. This compound is typically a colorless liquid or solid, depending on temperature, and exhibits a distinct aromatic odor. Its molecular structure contributes to its chemical stability, although the presence of halogens can enhance its reactivity in certain conditions, particularly in electrophilic substitution reactions. The compound is of interest in various fields, including organic synthesis and materials science, due to its unique properties and potential applications. Additionally, it is important to handle this substance with care, as halogenated compounds can pose environmental and health risks, necessitating proper safety protocols during use and disposal.
Formula:C6HBr2F3
InChI:InChI=1S/C6HBr2F3/c7-4-2(9)1-3(10)5(8)6(4)11/h1H
InChI key:SFNQFVCUPVBCOC-UHFFFAOYSA-N
SMILES:C1=C(C(=C(C(=C1F)Br)F)Br)F
Found 4 products.