CAS 363165-80-4
:1,3-dihydro-2H-isoindol-2-ylacetic acid
Description:
1,3-Dihydro-2H-isoindol-2-ylacetic acid is a chemical compound characterized by its unique bicyclic structure, which includes an isoindole moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. It is typically a white to off-white solid at room temperature and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation. Overall, 1,3-dihydro-2H-isoindol-2-ylacetic acid represents a versatile structure with potential applications in various fields of research.
Formula:C10H11NO2
InChI:InChI=1/C10H11NO2/c12-10(13)7-11-5-8-3-1-2-4-9(8)6-11/h1-4H,5-7H2,(H,12,13)
SMILES:c1ccc2CN(Cc2c1)CC(=O)O
Synonyms:- 2H-Isoindole-2-acetic acid, 1,3-dihydro-
- 1,3-Dihydro-2H-isoindol-2-ylacetic acid
- 2-(Isoindolin-2-yl)acetic acid
- (1,3-DIHYDRO-ISOINDOL-2-YL)-ACETIC ACID
- 1,3-dihydro-2H-isoindol-2-ylacetic acid(SALTDATA: HCl)
- CHEMBRDG-BB 4003155
- UKRORGSYN-BB BBV-182318
- AKOS BB-9356
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
