CymitQuimica logo

CAS 3637-13-6

:

5-Oxoheptanoic acid

Description:
5-Oxoheptanoic acid, with the CAS number 3637-13-6, is a carboxylic acid characterized by its seven-carbon chain and a ketone functional group at the fifth carbon position. This compound features a molecular structure that includes both a carboxylic acid (-COOH) and a ketone (C=O), which contributes to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the carboxylic acid group makes it acidic, allowing it to participate in various chemical reactions, such as esterification and amidation. 5-Oxoheptanoic acid can be used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Its solubility in polar solvents, such as water and alcohols, enhances its utility in chemical processes. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken due to potential irritant properties.
Formula:C7H12O3
InChI:InChI=1S/C7H12O3/c1-2-6(8)4-3-5-7(9)10/h2-5H2,1H3,(H,9,10)
InChI key:InChIKey=PHADZMIQVBXNAW-UHFFFAOYSA-N
SMILES:C(CCCC(O)=O)(CC)=O
Synonyms:
  • 5-Oxoheptanoic acid
  • Heptanoic acid, 5-oxo-
  • See more synonyms
Found 4 products.