CAS 3642-91-9
:N-CBZ-?-Alanine p-nitrophenyl ester N-Carbobenzyloxy-?-alanine p-nitrophenyl ester
Description:
N-CBZ-β-Alanine p-nitrophenyl ester, also known as N-Carbobenzyloxy-β-alanine p-nitrophenyl ester, is a chemical compound characterized by its ester functional group and the presence of a carbobenzyloxy (CBZ) protecting group. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but has limited solubility in water. The p-nitrophenyl ester moiety is known for its reactivity, particularly in peptide synthesis, where it can serve as an activated carboxylic acid derivative. The CBZ group provides protection for the amino group during chemical reactions, making it useful in synthetic organic chemistry and peptide synthesis. The compound is often utilized in research and development settings, particularly in the synthesis of peptides and other bioactive molecules. As with many chemical substances, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C17H16N2O6
InChI:InChI=1S/C17H16N2O6/c20-16(25-15-8-6-14(7-9-15)19(22)23)10-11-18-17(21)24-12-13-4-2-1-3-5-13/h1-9H,10-12H2,(H,18,21)
InChI key:ZVWBGQBOHVVMEB-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COC(=O)NCCC(=O)OC2=CC=C(C=C2)[N+](=O)[O-]
Synonyms:- Z-beta-Ala-ONp
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery


