CAS 36436-65-4: 2′-Hydroxy-4′,5′-dimethylacetophenone
Description:2′-Hydroxy-4′,5′-dimethylacetophenone, with the CAS number 36436-65-4, is an organic compound that belongs to the class of acetophenones. It features a hydroxyl group (-OH) and two methyl groups (-CH3) on the aromatic ring, contributing to its unique chemical properties. This compound is characterized by its moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic structure. It exhibits a ketone functional group, which is responsible for its reactivity in various chemical reactions, including nucleophilic additions and oxidation processes. The presence of the hydroxyl group also allows for potential hydrogen bonding, influencing its physical properties such as boiling and melting points. Additionally, 2′-Hydroxy-4′,5′-dimethylacetophenone may have applications in organic synthesis, as well as in the production of dyes, fragrances, and pharmaceuticals, owing to its ability to act as an intermediate in various chemical reactions. Its safety and handling should be approached with caution, as with many organic compounds, to mitigate any potential health risks.
Formula:C10H12O2
InChI:InChI=1S/C10H12O2/c1-6-4-9(8(3)11)10(12)5-7(6)2/h4-5,12H,1-3H3
InChI key:InChIKey=YXVSURZEXVMUAM-UHFFFAOYSA-N
SMILES:O=C(C=1C=C(C(=CC1O)C)C)C
- Synonyms:
- 1-(2-Hydroxy-4,5-Dimethylphenyl)Ethanone
- 1-(2-Hydroxy-4,5-dimethylphenyl)ethan-1-one
- 1-(4,5-Dimethyl-2-hydroxyphenyl)ethanone
- 2-Acetyl-4,5-dimethylphenol
- 2′-Hydroxy-4′,5′-dimethylacetophenone
- 4,5-Dimethyl-2-hydroxyacetophenone
- Acetophenone, 2′-hydroxy-4′,5′-dimethyl-
- Ethanone, 1-(2-hydroxy-4,5-dimethylphenyl)-
