CymitQuimica logo

CAS 36476-82-1

:

1-(DIPHENYLMETHYL)-3-METHOXYAZETIDINE

Description:
1-(DIPHENYLMETHYL)-3-METHOXYAZETIDINE, with the CAS number 36476-82-1, is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. This compound features a diphenylmethyl group, contributing to its unique properties, including potential lipophilicity and steric hindrance. The methoxy group at the 3-position of the azetidine ring enhances its chemical reactivity and solubility in organic solvents. The presence of both aromatic and aliphatic components suggests that it may exhibit interesting pharmacological activities, possibly influencing its interaction with biological targets. The compound's molecular structure allows for various stereochemical configurations, which can affect its biological activity and interactions. As with many azetidine derivatives, it may be of interest in medicinal chemistry for its potential applications in drug development. However, specific biological activities, toxicity, and detailed physicochemical properties would require further investigation through experimental studies.
Formula:C17H19NO
InChI:InChI=1S/C17H19NO/c1-19-16-12-18(13-16)17(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,16-17H,12-13H2,1H3
InChI key:GBJQFXRPQYYFOX-UHFFFAOYSA-N
SMILES:COC1CN(C1)C(C2=CC=CC=C2)C3=CC=CC=C3
Found 3 products.