CAS 36556-06-6: 5,6,7,8-Tetrahydroisoquinoline
Description:5,6,7,8-Tetrahydroisoquinoline is a bicyclic organic compound characterized by its fused isoquinoline structure, which includes a saturated piperidine ring. It is a colorless to pale yellow liquid or solid, depending on its form and purity. This compound is known for its role as a building block in organic synthesis and has garnered interest in medicinal chemistry due to its potential biological activities, including neuroprotective and anti-cancer properties. The presence of nitrogen in its structure allows for various chemical modifications, making it versatile in the development of pharmaceuticals. Its solubility can vary based on the solvent used, and it typically exhibits moderate stability under standard conditions. Additionally, 5,6,7,8-Tetrahydroisoquinoline can participate in various chemical reactions, such as alkylation and acylation, which are useful in synthesizing more complex molecules. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid inhalation or skin contact.
Formula:C9H11N
InChI:InChI=1S/C9H11N/c1-2-4-9-7-10-6-5-8(9)3-1/h5-7H,1-4H2
InChI key:InChIKey=HTMGQIXFZMZZKD-UHFFFAOYSA-N
SMILES:N=1C=CC2=C(C1)CCCC2
- Synonyms:
- 5,6,7,8-Tetrahydroisoquinoline
- Isoquinoline, 5,6,7,8-tetrahydro-

5,6,7,8-Tetrahydroisoquinoline
Ref: 3B-T1230
25ml | 141.00 € |

5,6,7,8-Tetrahydroisoquinoline
Ref: IN-DA003M9A
1g | 37.00 € | ||
5g | 47.00 € | ||
10g | 68.00 € | ||
25g | 119.00 € | ||
100g | 240.00 € | ||
500g | To inquire |

Ref: 54-OR951474
5g | 32.00 € | ||
25g | 122.00 € | ||
100g | 427.00 € | ||
500g | 1,573.00 € |

5,6,7,8-TETRAHYDROISOQUINOLINE
Ref: 10-F304059
1g | 12.00 € | ||
5g | 24.00 € | ||
10g | 42.00 € | ||
25g | 79.00 € | ||
100g | 252.00 € | ||
500g | 1,092.00 € |

5,6,7,8-Tetrahydroisoquinoline
Ref: 3D-LBA55606
25g | 373.00 € |