CAS 36556-06-6
:5,6,7,8-Tetrahydroisoquinoline
Description:
5,6,7,8-Tetrahydroisoquinoline is a bicyclic organic compound characterized by its fused isoquinoline structure, which includes a saturated piperidine ring. It is a colorless to pale yellow liquid or solid, depending on its form and purity. This compound is known for its role as a building block in organic synthesis and has garnered interest in medicinal chemistry due to its potential biological activities, including neuroprotective and anti-cancer properties. The presence of nitrogen in its structure allows for various chemical modifications, making it versatile in the development of pharmaceuticals. Its solubility can vary based on the solvent used, and it typically exhibits moderate stability under standard conditions. Additionally, 5,6,7,8-Tetrahydroisoquinoline can participate in various chemical reactions, such as alkylation and acylation, which are useful in synthesizing more complex molecules. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid inhalation or skin contact.
Formula:C9H11N
InChI:InChI=1S/C9H11N/c1-2-4-9-7-10-6-5-8(9)3-1/h5-7H,1-4H2
InChI key:InChIKey=HTMGQIXFZMZZKD-UHFFFAOYSA-N
SMILES:C1=2C(CCCC1)=CN=CC2
Synonyms:- 5,6,7,8-Tetrahydroisoquinoline
- Isoquinoline, 5,6,7,8-tetrahydro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5,6,7,8-Tetrahydroisoquinoline
CAS:Formula:C9H11NPurity:>98.0%(GC)(T)Color and Shape:Colorless to Yellow to Orange clear liquidMolecular weight:133.195,6,7,8-Tetrahydroisoquinoline
CAS:5,6,7,8-TetrahydroisoquinolineFormula:C9H11NPurity:97%Color and Shape:LiquidMolecular weight:133.190345,6,7,8-Tetrahydroisoquinoline
CAS:Formula:C9H11NPurity:96%Color and Shape:LiquidMolecular weight:133.19035,6,7,8-Tetrahydroisoquinoline
CAS:5,6,7,8-Tetrahydroisoquinoline is a nitrogen-containing heterocyclic compound that can be used in biochemical experiments and drug synthesis research.Formula:C9H11NPurity:99.74%Color and Shape:SolidMolecular weight:133.195,6,7,8-TETRAHYDROISOQUINOLINE
CAS:Formula:C9H11NPurity:96%Color and Shape:LiquidMolecular weight:133.1945,6,7,8-Tetrahydroisoquinoline
CAS:Tetrahydroisoquinoline is an organic compound with the chemical formula C8H10N2. It is a colorless crystalline solid that is soluble in water and has a sweet odor. Tetrahydroisoquinoline can be synthesized by combining l-tartaric acid and amastigote. The reaction time for this synthesis can vary between 1 hour to 4 days, depending on temperature. Tetrahydroisoquinoline is an organic compound that can be used as a ligand for hydrogenation reactions and as a kinetic probe for enzymatic reactions. It also has been shown to interact with dehydrogenases, which are enzymes that catalyze the removal of hydrogen from certain molecules. Tetrahydroisoquinoline forms stable complexes with these enzymes, which allows kinetic studies to be conducted at various concentrations.Formula:C9H11NPurity:Min. 95%Molecular weight:133.19 g/mol





