CymitQuimica logo

CAS 366-44-9

:

2-chloro-N-(4-fluoro-2-methylphenyl)acetamide

Description:
2-Chloro-N-(4-fluoro-2-methylphenyl)acetamide, with the CAS number 366-44-9, is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a chloro substituent on the second carbon of the acetamide, and a 4-fluoro-2-methylphenyl group attached to the nitrogen atom. The presence of the chlorine and fluorine atoms contributes to its potential reactivity and biological activity. Typically, compounds like this may exhibit properties such as moderate solubility in organic solvents and varying degrees of stability depending on environmental conditions. The molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where halogenated compounds often play a role in enhancing biological activity or modifying physical properties. Additionally, the presence of the aromatic ring may influence the compound's interaction with biological targets, making it of interest in medicinal chemistry. As with many halogenated organic compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.
Formula:C9H9ClFNO
InChI:InChI=1/C9H9ClFNO/c1-6-4-7(11)2-3-8(6)12-9(13)5-10/h2-4H,5H2,1H3,(H,12,13)
SMILES:Cc1cc(ccc1NC(=O)CCl)F
Synonyms:
  • acetamide, 2-chloro-N-(4-fluoro-2-methylphenyl)-
Found 1 products.