CAS 3663-37-4
:3-Phenyl-1,2,4-oxadiazol-5-amine
Description:
3-Phenyl-1,2,4-oxadiazol-5-amine is an organic compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of a phenyl group at the 3-position of the oxadiazole enhances its aromatic properties and can influence its reactivity and solubility. This compound typically exhibits moderate to high stability under standard conditions, but its reactivity can vary depending on the functional groups present. It is often utilized in various fields, including pharmaceuticals and materials science, due to its potential biological activity and ability to form coordination complexes. The amine group at the 5-position can participate in hydrogen bonding and nucleophilic reactions, making it a versatile building block in organic synthesis. Additionally, the compound may exhibit fluorescence or other photophysical properties, which can be advantageous in applications such as sensors or dyes. Overall, 3-Phenyl-1,2,4-oxadiazol-5-amine is a compound of interest for its unique structural features and potential applications in diverse chemical contexts.
Formula:C8H7N3O
InChI:InChI=1S/C8H7N3O/c9-8-10-7(11-12-8)6-4-2-1-3-5-6/h1-5H,(H2,9,10,11)
InChI key:InChIKey=DZHVJUCGKWKRTO-UHFFFAOYSA-N
SMILES:NC1=NC(=NO1)C2=CC=CC=C2
Synonyms:- (3-Phenyl-[1,2,4]oxadiazol-5-yl)amine
- 1,2,4-Oxadiazol-5-amine, 3-phenyl-
- 1,2,4-Oxadiazole, 5-amino-3-phenyl-
- 3-Phenyl-1,2,4-oxadiazol-5-amine
- Ai3-61762
- 5-Amino-3-phenyl-1,2,4-oxadiazole
- 5-Amino-3-phenyl-1,2,4-oxadiazole
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Phenyl-1,2,4-oxadiazol-5-amine
CAS:3-Phenyl-1,2,4-oxadiazol-5-amine is a synthetic compound that is used for the study of mechanistic and stereochemical aspects of organic reactions. It has been shown to be an effective nucleophile in many different reactions. 3-Phenyl-1,2,4-oxadiazol-5-amine can undergo rearrangements and is a good substrate for thioamides. This compound also reacts with thioureas and thiocarbamates, which are both reactive compounds that are commonly used in organic chemistry. 3-Phenyl-1,2,4-oxadiazol-5-amine reacts with thiols to form photochemically active organosulfur compounds. The photoinduced reaction can be carried out by irradiating the compound with ultraviolet light or visible light.Formula:C8H7N3OPurity:Min. 95%Molecular weight:161.16 g/mol

