CymitQuimica logo

CAS 366496-33-5

:

1,4-Dibromo-2-fluoro-5-nitrobenzene

Description:
1,4-Dibromo-2-fluoro-5-nitrobenzene is an aromatic compound characterized by the presence of two bromine atoms, one fluorine atom, and one nitro group attached to a benzene ring. This compound features a complex substitution pattern, with the bromine atoms located at the 1 and 4 positions, the fluorine at the 2 position, and the nitro group at the 5 position of the benzene ring. The presence of these electronegative substituents significantly influences its chemical properties, including its reactivity and polarity. The nitro group is a strong electron-withdrawing group, which can enhance the electrophilic character of the aromatic ring, making it more susceptible to further substitution reactions. Additionally, the bromine atoms can participate in nucleophilic substitution reactions, while the fluorine atom may affect the compound's overall stability and solubility in various solvents. This compound is of interest in various fields, including materials science and organic synthesis, due to its potential applications in the development of functional materials and pharmaceuticals.
Formula:C6H2Br2FNO2
InChI:InChI=1S/C6H2Br2FNO2/c7-3-2-6(10(11)12)4(8)1-5(3)9/h1-2H
InChI key:WDFCYQDGGDTTCT-UHFFFAOYSA-N
SMILES:C1=C(C(=CC(=C1Br)F)Br)[N+](=O)[O-]
Found 4 products.