CymitQuimica logo

CAS 367-28-2

:

2-fluorocyclohexa-2,5-diene-1,4-dione

Description:
2-Fluorocyclohexa-2,5-diene-1,4-dione, with the CAS number 367-28-2, is an organic compound characterized by its unique bicyclic structure featuring a diene and diketone functionality. This compound contains a fluorine atom substituent, which can influence its reactivity and physical properties. Typically, compounds of this nature exhibit resonance stabilization due to the conjugated double bonds, which can affect their electronic properties and reactivity patterns. The presence of the diketone moiety suggests potential for hydrogen bonding and reactivity in nucleophilic addition reactions. Additionally, the fluorine atom can enhance the compound's polarity and solubility in polar solvents. In terms of physical properties, such compounds may exhibit distinct UV-Vis absorption characteristics due to their conjugated systems. Overall, 2-fluorocyclohexa-2,5-diene-1,4-dione is of interest in various chemical applications, including synthetic organic chemistry and materials science, due to its unique structural features and potential reactivity.
Formula:C6H3FO2
InChI:InChI=1/C6H3FO2/c7-5-3-4(8)1-2-6(5)9/h1-3H
InChI key:XHKUTQNVGAHLPK-UHFFFAOYSA-N
SMILES:C1=CC(=O)C(=CC1=O)F
Found 3 products.