CymitQuimica logo

CAS 367-71-5

:

2,4-Bis(trifluoromethyl)aniline

Description:
2,4-Bis(trifluoromethyl)aniline, with the CAS number 367-71-5, is an organic compound characterized by the presence of two trifluoromethyl groups attached to the aniline structure. This compound features a benzene ring with an amino group (-NH2) and two trifluoromethyl groups (-CF3) located at the 2 and 4 positions. The presence of the electronegative fluorine atoms significantly influences its chemical properties, enhancing its lipophilicity and stability. 2,4-Bis(trifluoromethyl)aniline is typically a solid at room temperature and is known for its applications in the synthesis of various pharmaceuticals and agrochemicals. It exhibits strong electron-withdrawing effects due to the trifluoromethyl groups, which can affect its reactivity and interaction with other chemical species. Additionally, this compound may have implications in materials science and organic synthesis due to its unique electronic properties. Safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C8H5F6N
InChI:InChI=1/C8H5F6N/c9-7(10,11)4-1-2-6(15)5(3-4)8(12,13)14/h1-3H,15H2
InChI key:UIWVOUBVGBJRNP-UHFFFAOYSA-N
SMILES:c1cc(c(cc1C(F)(F)F)C(F)(F)F)N
Synonyms:
  • Fxffr Bz Exfff
  • 2,4-Bis Trifluoromethyl aniline
Found 5 products.