CymitQuimica logo

CAS 367250-06-4

:

5-(aminomethyl)-1,2-dihydro-3H-1,2,4-Triazol-3-one, hydrochloride

Description:
5-(Aminomethyl)-1,2-dihydro-3H-1,2,4-triazol-3-one, hydrochloride, is a chemical compound characterized by its triazole ring structure, which contributes to its biological activity. This compound typically appears as a white to off-white crystalline solid and is soluble in water, making it suitable for various applications in pharmaceuticals and biochemistry. The presence of the amino group enhances its reactivity and potential for forming hydrogen bonds, which can influence its interaction with biological targets. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. The compound may exhibit antimicrobial or antifungal properties, making it of interest in medicinal chemistry. Its molecular structure allows for potential modifications that can enhance its efficacy or selectivity in therapeutic applications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C3H7ClN4O
InChI:InChI=1S/C3H6N4O.ClH/c4-1-2-5-3(8)7-6-2;/h1,4H2,(H2,5,6,7,8);1H
InChI key:CBVIQSDAULZQOS-UHFFFAOYSA-N
SMILES:C(c1nc(n[nH]1)O)N.Cl
Synonyms:
  • 5-Aminomethyl-2,4-Dihydro-[1,2,4]Triazol-3-One Hydrochloride
Found 2 products.