CymitQuimica logo

CAS 36748-89-7

:

2-Iodobenzothiophene

Description:
2-Iodobenzothiophene is an organic compound characterized by its structure, which consists of a benzothiophene ring substituted with an iodine atom at the second position. This compound features a fused bicyclic system that includes a thiophene ring, contributing to its aromatic properties and potential reactivity. The presence of the iodine atom enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. 2-Iodobenzothiophene is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows it to participate in the synthesis of more complex organic molecules, particularly in the fields of materials science and medicinal chemistry. Additionally, compounds like 2-iodobenzothiophene are often studied for their potential applications in organic electronics, such as in the development of organic semiconductors and photovoltaic devices. Safety precautions should be observed when handling this compound, as iodine can be hazardous, and proper storage conditions are necessary to maintain its stability.
Formula:C8H5IS
InChI:InChI=1S/C8H5IS/c9-8-5-6-3-1-2-4-7(6)10-8/h1-5H
InChI key:InChIKey=XNCFWDHWACGQBN-UHFFFAOYSA-N
SMILES:IC1=CC=2C(S1)=CC=CC2
Synonyms:
  • 2-Iodobenzo[b]thiophene
  • 2-Iodobenzothiophene
  • Benzo[b]thiophene, 2-iodo-
  • 2-Iodo-1-benzothiophene
Found 4 products.