CymitQuimica logo

CAS 36764-94-0

:

2-Amino-3,5-dichlorobenzonitrile

Description:
2-Amino-3,5-dichlorobenzonitrile is an organic compound characterized by the presence of an amino group (-NH2), two chlorine atoms, and a nitrile group (-C≡N) attached to a benzene ring. Its molecular structure features a dichlorobenzene framework, where the chlorine substituents are located at the 3 and 5 positions relative to the amino group. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent properties. It is often used in chemical synthesis and research, particularly in the development of pharmaceuticals and agrochemicals. The presence of both the amino and nitrile functional groups suggests potential reactivity in nucleophilic substitution and other organic reactions. Safety data indicates that it should be handled with care, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be taken during its use in laboratory settings.
Formula:C7H4Cl2N2
InChI:InChI=1/C7H4Cl2N2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-2H,11H2
InChI key:ZHKNDJRPOVUPMT-UHFFFAOYSA-N
SMILES:c1c(C#N)c(c(cc1Cl)Cl)N
Found 5 products.