CAS 36772-63-1

7-chloro-1,2,3-benzotriazin-4(1H)-one

Description:

7-Chloro-1,2,3-benzotriazin-4(1H)-one, with the CAS number 36772-63-1, is a heterocyclic organic compound characterized by its benzotriazine structure, which includes a chlorine substituent at the 7-position and a carbonyl group at the 4-position. This compound typically exhibits a crystalline solid form and is soluble in polar organic solvents. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its ability to interact with biological systems. The presence of the chlorine atom may enhance its reactivity and influence its biological activity. Additionally, the compound may exhibit properties such as UV absorbance, making it useful in photostability studies. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₄ClN₃O

InChI: InChI=1/C7H4ClN3O/c8-4-1-2-5-6(3-4)9-11-10-7(5)12/h1-3H,(H,9,10,12)

Synonyms:

• 1,2,3-Benzotriazin-4(3H)-one,7-chloro-
• 7-chloro-3,4-dihydro-1,2,3-benzotriazin-4-one
• 7-Chlorobenzo[d][1,2,3]triazin-4(1H)-one

7-Chloro-3,4-dihydro-1,2,3-benzotriazin-4-one

CAS: 36772-63-1

Versatile small molecule scaffold

Formula: C₇H₄ClN₃O

Purity: Min. 95%

Molecular weight: 181.58 g/mol

Ref: 3D-LBA77263