CymitQuimica logo

CAS 367954-99-2

:

2,4-Difluoro-5-methylbenzoic acid

Description:
2,4-Difluoro-5-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms and a methyl group on a benzoic acid framework. The molecular structure features a benzene ring substituted at the 2 and 4 positions with fluorine atoms and at the 5 position with a methyl group, contributing to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic system and fluorine substituents. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the fluorine atoms can enhance the compound's stability and influence its reactivity, making it of interest in medicinal chemistry and materials science. Its CAS number, 367954-99-2, is a unique identifier that facilitates its recognition in chemical databases and literature.
Formula:C8H6F2O2
InChI:InChI=1/C8H6F2O2/c1-4-2-5(8(11)12)7(10)3-6(4)9/h2-3H,1H3,(H,11,12)
InChI key:YWQRTHMEMOUEPW-UHFFFAOYSA-N
SMILES:Cc1cc(c(cc1F)F)C(=O)O
Synonyms:
  • 4,6-Difluoro-m-toluic acid
  • Benzoic acid, 2,4-difluoro-5-methyl-
  • Qvr Bf Df E1
Found 4 products.