CymitQuimica logo

CAS 36853-14-2

:

�Ethyl 2,4-dimethyl-6-oxo-1,6-dihydro-3-pyridinecarboxylate

Description:
Ethyl 2,4-dimethyl-6-oxo-1,6-dihydro-3-pyridinecarboxylate, with the CAS number 36853-14-2, is an organic compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring substituted with various functional groups, including an ethyl ester and multiple methyl groups, contributing to its unique chemical properties. The presence of the keto group (6-oxo) indicates that it has a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions. The dihydropyridine structure suggests that it may exhibit reduced reactivity compared to fully aromatic pyridines, potentially influencing its behavior in biological systems or synthetic applications. Ethyl 2,4-dimethyl-6-oxo-1,6-dihydro-3-pyridinecarboxylate may be of interest in medicinal chemistry and organic synthesis due to its potential biological activity and utility as a building block in the synthesis of more complex molecules. As with many organic compounds, its physical properties, such as solubility and melting point, would depend on the specific conditions and purity of the sample.
Formula:C10H13NO3
InChI:InChI=1S/C10H13NO3/c1-4-14-10(13)9-6(2)5-8(12)11-7(9)3/h5H,4H2,1-3H3,(H,11,12)
InChI key:XIRRHMRGKFDBIA-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(NC(=O)C=C1C)C
Found 3 products.