CymitQuimica logo

CAS 3687-16-9

:

N~1~,N~3~-bis(2-ethylhexyl)-2-methylpropane-1,2,3-triamine

Description:
N,N-bis(2-ethylhexyl)-2-methylpropane-1,2,3-triamine, with CAS number 3687-16-9, is a branched-chain aliphatic amine characterized by its three amine functional groups and long hydrophobic alkyl chains. This compound typically exhibits properties such as high solubility in organic solvents and limited solubility in water, which is common for amines with long hydrocarbon tails. Its structure allows for potential applications in various fields, including as a surfactant, emulsifier, or in the formulation of corrosion inhibitors. The presence of multiple amine groups can enhance its reactivity, making it useful in chemical synthesis and as a ligand in coordination chemistry. Additionally, due to its hydrophobic nature, it may interact favorably with non-polar substances, which can be advantageous in certain industrial applications. Safety considerations should be taken into account, as amines can be irritants and may pose environmental risks if not handled properly. Overall, this compound's unique structure and properties make it a versatile chemical in various applications.
Formula:C20H45N3
InChI:InChI=1/C20H45N3/c1-6-10-12-18(8-3)14-22-16-20(5,21)17-23-15-19(9-4)13-11-7-2/h18-19,22-23H,6-17,21H2,1-5H3
InChI key:STNVDPRWLDHKCY-UHFFFAOYSA-N
SMILES:CCCCC(CC)CNCC(C)(CNCC(CC)CCCC)N
Found 4 products.