CymitQuimica logo

CAS 368866-34-6

:

(αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]tetrahydro-2H-pyran-4-propanoic acid

Description:
The chemical substance known as (αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]tetrahydro-2H-pyran-4-propanoic acid, with the CAS number 368866-34-6, is a synthetic compound primarily used in the field of peptide chemistry and drug development. It features a tetrahydropyran ring, which contributes to its cyclic structure and potential biological activity. The presence of the fluorenylmethoxycarbonyl (Fmoc) group indicates its application in solid-phase peptide synthesis, serving as a protective group for amino acids. This compound is characterized by its chiral center, denoted by the (αS) configuration, which is crucial for its interaction with biological targets. The overall structure suggests that it may exhibit specific stereochemical properties that influence its reactivity and binding affinity. Additionally, the propanoic acid moiety indicates potential acidity, which may play a role in its solubility and stability in various environments. Overall, this compound is significant in research and development, particularly in the synthesis of biologically active peptides.
Formula:C23H25NO5
InChI:InChI=1S/C23H25NO5/c25-22(26)21(13-15-9-11-28-12-10-15)24-23(27)29-14-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,15,20-21H,9-14H2,(H,24,27)(H,25,26)/t21-/m0/s1
InChI key:InChIKey=GHWBOWNFASFNHK-NRFANRHFSA-N
SMILES:C(OC(N[C@@H](CC1CCOCC1)C(O)=O)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:
  • (2S)-2-([[(9H-Fluoren-9-yl)methoxy]carbonyl]amino)-3-(oxan-4-yl)propanoic acid
  • 2H-Pyran-4-propanoic acid, α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]tetrahydro-, (αS)-
  • (αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]tetrahydro-2H-pyran-4-propanoic acid
Found 5 products.