CymitQuimica logo

CAS 369-22-2

:

2,4,6-tris(difluoromethyl)-1,3,5-triazine

Description:
2,4,6-Tris(difluoromethyl)-1,3,5-triazine, with the CAS number 369-22-2, is a heterocyclic organic compound characterized by its triazine ring structure, which features three difluoromethyl groups attached to the 2, 4, and 6 positions. This compound is notable for its high thermal stability and resistance to degradation, making it useful in various applications, including as a precursor in the synthesis of agrochemicals and pharmaceuticals. The presence of difluoromethyl groups enhances its lipophilicity and can influence its reactivity and biological activity. Additionally, 2,4,6-tris(difluoromethyl)-1,3,5-triazine exhibits properties that may include being a potential candidate for flame retardants or as a building block in materials science. Its unique electronic properties, derived from the electronegative fluorine atoms, can also affect its interaction with other chemical species. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C6H3F6N3
InChI:InChI=1/C6H3F6N3/c7-1(8)4-13-5(2(9)10)15-6(14-4)3(11)12/h1-3H
SMILES:C(c1nc(C(F)F)nc(C(F)F)n1)(F)F
Synonyms:
  • 1,3,5-Triazine, 2,4,6-Tris(Difluoromethyl)-
  • 2,4,6-Tris(difluoromethyl)-1,3,5-triazine
Found 2 products.