CymitQuimica logo

CAS 369376-68-1

:

1-Benzoxepin-3(2H)-one

Description:
1-Benzoxepin-3(2H)-one, with the CAS number 369376-68-1, is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a benzene ring and an oxepin moiety. This compound typically exhibits a fused ring system, which contributes to its stability and potential reactivity. It is often studied for its biological activity, particularly in medicinal chemistry, due to the presence of the benzoxepin framework that can influence pharmacological properties. The compound may display various functional groups that can participate in chemical reactions, making it a candidate for further synthetic modifications. Its solubility and stability can vary depending on the solvent and environmental conditions. Additionally, 1-Benzoxepin-3(2H)-one may exhibit interesting optical properties, which can be relevant in the development of materials or pharmaceuticals. Overall, this compound represents a significant area of interest in organic synthesis and drug development, with ongoing research aimed at exploring its potential applications.
Formula:C10H8O2
InChI:InChI=1S/C10H8O2/c11-9-6-5-8-3-1-2-4-10(8)12-7-9/h1-6H,7H2
InChI key:AUXWDVCAVGNSQH-UHFFFAOYSA-N
SMILES:C1C(=O)C=CC2=CC=CC=C2O1
Found 1 products.