CymitQuimica logo

CAS 369403-44-1

:

[1,1'-Biphenyl]-4-acetic acid, a-[[(1,1-dimethylethoxy)carbonyl]amino]-

Description:
[1,1'-Biphenyl]-4-acetic acid, a-[[(1,1-dimethylethoxy)carbonyl]amino]- is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features an acetic acid functional group and an amino group that is protected by a dimethylethoxycarbonyl (DMEC) moiety, which enhances its stability and solubility. The presence of the biphenyl moiety contributes to its potential applications in pharmaceuticals and organic synthesis, as biphenyl derivatives often exhibit interesting biological activities. The compound is likely to be a white to off-white solid, with moderate solubility in organic solvents. Its molecular structure suggests it may participate in hydrogen bonding due to the carboxylic acid and amino groups, influencing its reactivity and interactions in various chemical environments. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C19H21NO4
InChI:InChI=1S/C19H21NO4/c1-19(2,3)24-18(23)20-16(17(21)22)15-11-9-14(10-12-15)13-7-5-4-6-8-13/h4-12,16H,1-3H3,(H,20,23)(H,21,22)
InChI key:IGQRMCQSKDTFDV-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC(C1=CC=C(C=C1)C2=CC=CC=C2)C(=O)O
Found 5 products.