CymitQuimica logo

CAS 36947-69-0

:

2-(1,1-Dimethylethyl)-1H-imidazole

Description:
2-(1,1-Dimethylethyl)-1H-imidazole, also known as a derivative of imidazole, is an organic compound characterized by its five-membered aromatic ring containing two nitrogen atoms. This compound features a tert-butyl group (1,1-dimethylethyl) attached to the second carbon of the imidazole ring, which influences its physical and chemical properties. Typically, it appears as a colorless to pale yellow liquid or solid, depending on the specific conditions. The presence of the bulky tert-butyl group enhances its lipophilicity, making it more soluble in organic solvents than in water. This compound may exhibit biological activity, potentially serving as a ligand in coordination chemistry or as a precursor in the synthesis of pharmaceuticals and agrochemicals. Its stability and reactivity can be influenced by the nitrogen atoms in the imidazole ring, which can participate in hydrogen bonding and coordination with metal ions. Overall, 2-(1,1-Dimethylethyl)-1H-imidazole is of interest in various fields, including medicinal chemistry and materials science.
Formula:C7H12N2
InChI:InChI=1S/C7H12N2/c1-7(2,3)6-8-4-5-9-6/h4-5H,1-3H3,(H,8,9)
InChI key:InChIKey=CTUNHIMNHSKDBN-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C=1NC=CN1
Synonyms:
  • 1H-Imidazole, 2-(1,1-dimethylethyl)-
  • 2-tert-Butyl-1H-imidazole
  • 2-tert-Butylimidazole
  • 2-(1,1-Dimethylethyl)-1H-imidazole
Found 4 products.