CymitQuimica logo

CAS 36968-94-2

:

4-(4-chlorobenzyl)piperidine hydrochloride (1:1)

Description:
4-(4-Chlorobenzyl)piperidine hydrochloride is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The presence of a 4-chlorobenzyl group enhances its lipophilicity, potentially influencing its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, particularly in medicinal chemistry. This compound may exhibit biological activity, making it of interest in drug development, particularly in the context of central nervous system disorders. Its molecular structure suggests potential interactions with neurotransmitter systems, although specific biological effects would depend on further empirical studies. Safety data indicate that, like many piperidine derivatives, it should be handled with care, as it may pose risks if ingested or inhaled. Proper storage conditions and handling protocols are essential to ensure safety and stability. Overall, 4-(4-chlorobenzyl)piperidine hydrochloride represents a significant compound in the realm of organic and medicinal chemistry.
Formula:C12H17Cl2N
InChI:InChI=1/C12H16ClN.ClH/c13-12-3-1-10(2-4-12)9-11-5-7-14-8-6-11;/h1-4,11,14H,5-9H2;1H
InChI key:CRYGKHFRQLLVHQ-UHFFFAOYSA-N
SMILES:c1cc(ccc1CC1CCNCC1)Cl.Cl
Synonyms:
  • Piperidine, 4-[(4-Chlorophenyl)Methyl]-, Hydrochloride (1:1)
  • 4-(4-Chlorobenzyl)piperidine hydrochloride (1:1)
Found 4 products.