CymitQuimica logo

CAS 370069-31-1

:

2-(Aminomethyl)-1-Boc-piperidine

Description:
2-(Aminomethyl)-1-Boc-piperidine is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The "Boc" (tert-butyloxycarbonyl) group is a common protecting group for amines, indicating that the compound has a primary amine functionality. This compound is typically used in organic synthesis, particularly in the preparation of pharmaceuticals and biologically active molecules. Its structure allows for various chemical modifications, making it versatile in synthetic chemistry. The presence of the aminomethyl group enhances its reactivity, enabling it to participate in further reactions such as coupling or alkylation. Additionally, the Boc group can be removed under acidic conditions, regenerating the free amine for subsequent reactions. The compound is generally handled with standard safety precautions, as with many amine-containing substances, due to potential reactivity and toxicity. Overall, 2-(Aminomethyl)-1-Boc-piperidine is a valuable intermediate in the synthesis of more complex organic compounds.
Formula:C11H22N2O2
InChI:InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-7-5-4-6-9(13)8-12/h9H,4-8,12H2,1-3H3
InChI key:PTVRCUVHYMGECC-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCCCC1CN
Synonyms:
  • 2-Aminomethyl-piperidine-1-carboxylic acid tert-butyl ester
  • 1-Boc-2-(Aminomethyl)piperidine
Found 5 products.