CymitQuimica logo

CAS 3702-12-3

:

1H-Pyrazol-5-amine,1-methyl-3-(1-methylethyl)-

Description:
1H-Pyrazol-5-amine, 1-methyl-3-(1-methylethyl)-, also known by its CAS number 3702-12-3, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an amine functional group, contributing to its basicity and potential reactivity. The presence of a methyl group and an isopropyl group enhances its hydrophobic characteristics, influencing its solubility in organic solvents. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential biological activity, including anti-inflammatory and analgesic properties. The molecular structure allows for various interactions, making it a candidate for further research in drug development. Additionally, the compound's stability and reactivity can be influenced by the substituents on the pyrazole ring, which may affect its synthesis and application in various chemical reactions. Overall, 1H-Pyrazol-5-amine, 1-methyl-3-(1-methylethyl)- is a versatile compound with potential applications in pharmaceuticals and agrochemicals.
Formula:C7H13N3
InChI:InChI=1S/C7H13N3/c1-5(2)6-4-7(8)10(3)9-6/h4-5H,8H2,1-3H3
InChI key:KGEGNOFPNKTJNU-UHFFFAOYSA-N
SMILES:CC(C)C1=NN(C(=C1)N)C
Synonyms:
  • Pyrazole, 5-amino-3-isopropyl-1-methyl- (6CI,7CI,8CI)
  • 3-Isopropyl-1-methyl-1H-pyrazol-5-amine
  • 5-Amino-1-methyl-3-isopropylpyrazole
Found 3 products.