CymitQuimica logo

CAS 37088-67-8

:

methyl 3-amino-3-phenylpropanoate

Description:
Methyl 3-amino-3-phenylpropanoate, with the CAS number 37088-67-8, is an organic compound characterized by its ester functional group and an amino group attached to a phenyl-substituted propanoate structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and methanol, but its solubility in water is limited due to the hydrophobic nature of the phenyl group. The presence of the amino group allows for potential reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in organic synthesis and pharmaceutical applications. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, methyl 3-amino-3-phenylpropanoate is a versatile compound with applications in both research and industry.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c1-13-10(12)7-9(11)8-5-3-2-4-6-8/h2-6,9H,7,11H2,1H3
InChI key:XKIOBYHZFPTKCZ-SECBINFHSA-N
SMILES:COC(=O)CC(c1ccccc1)N
Synonyms:
  • 3-Amino-3-phenyl-propionic acid methyl ester
Found 3 products.