CymitQuimica logo

CAS 37110-18-2

:

Dihydroxyacetoneoxime

Description:
Dihydroxyacetone oxime is an organic compound characterized by the presence of both hydroxyl (-OH) and oxime (-C=N-OH) functional groups. It is a derivative of dihydroxyacetone, which is a simple carbohydrate. The compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. Dihydroxyacetone oxime is known for its potential applications in various fields, including pharmaceuticals and agriculture, due to its ability to act as a precursor in the synthesis of other chemical compounds. Its oxime functionality allows for reactivity in condensation reactions, making it useful in organic synthesis. Additionally, the presence of hydroxyl groups contributes to its solubility in polar solvents. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, dihydroxyacetone oxime is a versatile compound with significant implications in chemical research and industrial applications.
Formula:C3H7NO3
InChI:InChI=1/C3H7NO3/c5-1-3(2-6)4-7/h5-7H,1-2H2
InChI key:SESFQRDUAZRWAW-UHFFFAOYSA-N
SMILES:C(C(=NO)CO)O
Synonyms:
  • 1,3-Dihydroxyacetone oxime
Found 3 products.