CymitQuimica logo

CAS 37149-18-1

:

4-carboxy-2,2,6,6-tetramethylpiperidine 1-oxyl

Description:
4-Carboxy-2,2,6,6-tetramethylpiperidine 1-oxyl, commonly referred to as a stable nitroxide radical, is characterized by its unique structure that includes a piperidine ring with four methyl groups and a carboxylic acid functional group. This compound is notable for its stability due to the presence of the nitroxide moiety, which allows it to act as a radical scavenger in various chemical reactions. It exhibits paramagnetic properties, making it useful in electron paramagnetic resonance (EPR) spectroscopy for studying molecular dynamics and interactions. The carboxylic acid group enhances its solubility in polar solvents and can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, this compound is often utilized in polymer chemistry as a spin label or as an antioxidant in various applications, including biological systems and materials science. Its ability to stabilize free radicals makes it valuable in research related to oxidative stress and radical-mediated processes.
Formula:C10H18NO3
InChI:InChI=1/C10H18NO3/c1-9(2)5-7(8(12)13)6-10(3,4)11(9)14/h7H,5-6H2,1-4H3,(H,12,13)
InChI key:CYQGCJQJIOARKD-UHFFFAOYSA-N
SMILES:CC1(C)CC(CC(C)(C)N1O)C(=O)O
Synonyms:
  • 4-Carboxy-Tempo
  • (4-Carboxy-2,2,6,6-Tetramethylpiperidin-1-Yl)Oxidanyl
Found 8 products.