CAS 37191-69-8
:β-Cyclodextrin hydrogen sulfate sodium salt
Description:
β-Cyclodextrin hydrogen sulfate sodium salt is a derivative of β-cyclodextrin, a cyclic oligosaccharide composed of seven glucose units. This compound is characterized by its ability to form inclusion complexes, which enhances the solubility and stability of various guest molecules, making it valuable in pharmaceutical and food applications. The presence of the hydrogen sulfate group introduces additional functional properties, such as increased solubility in water compared to its parent β-cyclodextrin. As a sodium salt, it exhibits ionic characteristics, contributing to its solubility and potential use in various formulations. β-Cyclodextrin hydrogen sulfate sodium salt is generally recognized as safe and is utilized in drug delivery systems, where it can improve the bioavailability of poorly soluble drugs. Its ability to encapsulate hydrophobic compounds makes it a versatile agent in enhancing the efficacy of active ingredients in various industries, including cosmetics and food technology. Overall, this compound combines the structural benefits of cyclodextrins with the functional advantages of sulfate groups, making it a significant substance in chemical and pharmaceutical research.
Formula:C42H70O35·xH2O4S·xNa
InChI:InChI=1S/C42H70O35.Na.H2O4S/c43-1-8-29-15(50)22(57)36(64-8)72-30-9(2-44)66-38(24(59)17(30)52)74-32-11(4-46)68-40(26(61)19(32)54)76-34-13(6-48)70-42(28(63)21(34)56)77-35-14(7-49)69-41(27(62)20(35)55)75-33-12(5-47)67-39(25(60)18(33)53)73-31-10(3-45)65-37(71-29)23(58)16(31)51;;1-5(2,3)4/h8-63H,1-7H2;;(H2,1,2,3,4)/t8-,9-,10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28?,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-;;/m1../s1
InChI key:InChIKey=VRCLBLYZZCJTIX-QGIWKRSGSA-N
SMILES:S(=O)(=O)(O)O.C(O)[C@@H]1[C@@]2([C@H](O)[C@@H](O)[C@](O1)(O[C@@]3([C@@H](CO)O[C@@]([C@H](O)[C@H]3O)(O[C@@]4([C@@H](CO)O[C@@](C(O)[C@H]4O)(O[C@@]5([C@@H](CO)O[C@](O[C@]6([C@H](O)[C@@H](O)[C@@](O[C@]7([C@H](O)[C@@H](O)[C@@](O[C@]8([C@H](O)[C@@H](O)[C@@](O2)(O[C@@H]8CO)[H])[H])(O[C@@H]7CO)[H])[H])(O[C@@H]6CO)[H])[H])([C@H](O)[C@H]5O)[H])[H])[H])[H])[H])[H])[H])[H].[Na]
Synonyms:- 2,4,7,9,12,14,17,19,22,24,27,29,32,34-Tetradecaoxaoctacyclo[31.2.2.2<sup>3,6</sup>.2<sup>8,11</sup>.2<sup>13,16</sup>.2<sup>18,21</sup>.2<sup>23,26</sup>.2<sup>28,31</sup>]nonatetracontane, β-cyclodextrin deriv.
- Sodium salt of sulfated cycloheptaamylose
- beta-Cyclodextrin, sulfated sodium salt
- β-Cyclodextrin hydrogen sulfate sodium salt
- 2,4,7,9,12,14,17,19,22,24,27,29,32,34-Tetradecaoxaoctacyclo[31.2.2.23,6.28,11.213,16.218,21.223,26.228,31]nonatetracontane, β-cyclodextrin deriv.
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
b-Cyclodextrin hydrogen sulfate, sodium salt
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Purity:Min. 95%Color and Shape:Powder



