CymitQuimica logo

CAS 371947-93-2

:

4(1H)-Quinazolinone, 2-[3-(acetyloxy)phenyl]-

Description:
4(1H)-Quinazolinone, 2-[3-(acetyloxy)phenyl]- is a chemical compound characterized by its quinazolinone core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidinone. This specific derivative features an acetyloxy group attached to a phenyl ring at the 2-position of the quinazolinone. The presence of the acetyloxy group suggests potential for reactivity and biological activity, as acetyl groups can influence solubility and interaction with biological targets. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for potential hydrogen bonding and interactions with enzymes or receptors, which could be explored in drug development. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the aromatic ring and the quinazolinone moiety. Overall, 4(1H)-Quinazolinone, 2-[3-(acetyloxy)phenyl]- represents a class of compounds that may have applications in pharmaceuticals or agrochemicals.
Formula:C16H12N2O3
InChI:InChI=1S/C16H12N2O3/c1-10(19)21-12-6-4-5-11(9-12)15-17-14-8-3-2-7-13(14)16(20)18-15/h2-9H,1H3,(H,17,18,20)
InChI key:RAPQKVQJRFXKQJ-UHFFFAOYSA-N
SMILES:CC(=O)OC1=CC=CC(=C1)C2=NC3=CC=CC=C3C(=O)N2
Found 3 products.