CymitQuimica logo

CAS 372144-02-0

:

β-Amino-1-[(1,1-dimethylethoxy)carbonyl]-4-piperidinepropanoic acid

Description:
β-Amino-1-[(1,1-dimethylethoxy)carbonyl]-4-piperidinepropanoic acid, with CAS number 372144-02-0, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a propanoic acid moiety, contributing to its potential as an amino acid derivative. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has a protective group that can influence its reactivity and solubility. This compound is likely to exhibit properties typical of amino acids, such as the ability to form hydrogen bonds and participate in various chemical reactions, including peptide bond formation. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperidine ring's role in enhancing biological activity. Additionally, the compound's solubility and stability can be influenced by the substituents on the piperidine and the carboxylic acid functional group, making it a subject of interest for further research in organic synthesis and drug design.
Formula:C13H24N2O4
InChI:InChI=1S/C13H24N2O4/c1-13(2,3)19-12(18)15-6-4-9(5-7-15)10(14)8-11(16)17/h9-10H,4-8,14H2,1-3H3,(H,16,17)
InChI key:InChIKey=COIKOWZPIUVFDC-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCC(C(CC(O)=O)N)CC1
Synonyms:
  • 3-Amino-3-[1-[(tert-butoxy)carbonyl]piperidin-4-yl]propanoic acid
  • 3-Amino-3-(1-Boc-4-piperidyl)propanoic Acid
  • β-Amino-1-[(1,1-dimethylethoxy)carbonyl]-4-piperidinepropanoic acid
  • 4-Piperidinepropanoic acid, β-amino-1-[(1,1-dimethylethoxy)carbonyl]-
  • 3-Amino-3-(1-(tert-butoxycarbonyl)piperidin-4-yl)propanoic acid
Found 3 products.