CymitQuimica logo

CAS 372198-69-1

:

Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate

Description:
Ethyl 6-bromoimidazo[1,2-a]pyridine-3-carboxylate is a chemical compound characterized by its unique structure, which includes an imidazole ring fused to a pyridine ring, along with a carboxylate ester functional group. The presence of the bromine atom at the 6-position of the imidazole ring contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The ethyl ester group enhances its lipophilicity, which can influence its pharmacokinetic properties. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile intermediate in organic synthesis. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C10H9BrN2O2
InChI:InChI=1S/C10H9BrN2O2/c1-2-15-10(14)8-5-12-9-4-3-7(11)6-13(8)9/h3-6H,2H2,1H3
InChI key:VMTDOHAWLUJHAI-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CN=C2N1C=C(C=C2)Br
Synonyms:
  • Imidazo[1,2-a]pyridine-3-carboxylic acid, 6-bromo-, ethyl ester
Found 4 products.