CAS 3722-66-5

1,1'-[propane-1,3-diylbis(oxy)]bis(4-bromobenzene)

Description:

1,1'-[Propane-1,3-diylbis(oxy)]bis(4-bromobenzene), with the CAS number 3722-66-5, is an organic compound characterized by its structure, which features two 4-bromobenzene units connected by a propane-1,3-diyl group through ether linkages. This compound exhibits properties typical of aromatic bromides, including potential applications in organic synthesis and materials science due to its bromine substituents, which can participate in various chemical reactions. The presence of ether linkages contributes to its solubility in organic solvents and may influence its thermal and mechanical properties. Additionally, the compound's molecular structure suggests it may exhibit interesting electronic properties, making it a candidate for studies in organic electronics or as a building block in polymer chemistry. Its stability and reactivity can be influenced by the bromine atoms, which can serve as leaving groups in nucleophilic substitution reactions. Overall, this compound represents a versatile structure with potential utility in various chemical applications.

Formula: C₁₅H₁₄Br₂O₂

InChI: InChI=1/C15H14Br2O2/c16-12-2-6-14(7-3-12)18-10-1-11-19-15-8-4-13(17)5-9-15/h2-9H,1,10-11H2

SMILES: C(COc1ccc(cc1)Br)COc1ccc(cc1)Br

1,3-Bis(4-bromophenoxy)propane

Controlled Product

CAS: 3722-66-5

Formula: C₁₅H₁₄Br₂O₂

Color and Shape: Neat

Molecular weight: 386.079

Ref: TR-B400057