CAS 373-68-2
:tetramethylammonium fluoride
Description:
Tetramethylammonium fluoride (TMAF) is an organic compound with the formula (CH₃)₄NF. It is a quaternary ammonium salt, characterized by a central nitrogen atom bonded to four methyl groups and a fluoride ion. TMAF is typically encountered as a white crystalline solid that is highly soluble in polar solvents such as water and alcohols. This solubility is attributed to the ionic nature of the fluoride ion, which facilitates interactions with solvent molecules. TMAF is known for its use as a reagent in organic synthesis, particularly in reactions involving fluoride ion transfer. It can act as a source of fluoride in various chemical processes, including nucleophilic substitutions and deprotection reactions. Additionally, TMAF exhibits properties that make it useful in electrochemical applications and as a phase transfer catalyst. However, it should be handled with care, as fluoride ions can be toxic and corrosive. Overall, tetramethylammonium fluoride is a versatile compound with significant applications in both academic and industrial chemistry.
Formula:C4H12FN
InChI:InChI=1/C4H12N.FH/c1-5(2,3)4;/h1-4H3;1H/q+1;/p-1
InChI key:InChIKey=GTDKXDWWMOMSFL-UHFFFAOYSA-M
SMILES:[N+](C)(C)(C)C.[F-]
Synonyms:- Ammonium, tetramethyl-, fluoride
- Methanaminium, N,N,N-trimethyl-, fluoride
- Methanaminium, N,N,N-trimethyl-, fluoride (1:1)
- N,N,N-trimethylmethanaminium fluoride
- Tetramethyl ammonium fluoride
- Tetramethylammonium fluoride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Tetramethylammonium Fluoride Tetrahydrate
CAS:Formula:C4H12FN·4H2OPurity:>98.0%(T)Color and Shape:White to Almost white powder to lumpMolecular weight:165.21tetramethylazanium fluoride
CAS:Formula:C4H12FNPurity:90%Color and Shape:SolidMolecular weight:93.1432Ref: IN-DA0035OH
20kgTo inquire2*25kgTo inquire250gTo inquire500gTo inquire1g25.00€5g51.00€10g72.00€25g124.00€50g158.00€100g259.00€1kg2,040.00€5kg9,047.00€Tetramethylammonium fluoride, anhydrous
CAS:Tetramethylammonium fluoride, anhydrousFormula:C4H12FNPurity:95%Color and Shape:SolidMolecular weight:93.14318TETRAMETHYLAMMONIUM FLUORIDE
CAS:Formula:C4H12FNPurity:95.0%Color and Shape:SolidMolecular weight:93.145Tetramethylammonium fluoride
CAS:Tetramethylammonium fluorideFormula:C4H12FNPurity:90%Molecular weight:93.14Tetramethylammoniumfluoride
CAS:Tetramethylammoniumfluoride (TMAF) is a hydroxide that reacts with hydrogen fluoride to form tetramethylammonium hydroxide, which has been shown to be an effective catalyst for the polymerase chain reaction. TMAF is also capable of generating glycol ethers from epoxides and other oxygen-containing compounds. It reacts with zirconium oxide to form zirconium tetra-methylammoniumoxide, which can be used as a nuclear fuel moderator. TMAF has a high boiling point and low volatility, making it an ideal solvent for analytical methods such as gas chromatography. TMAF is soluble in water at room temperature and decomposes at temperatures above 180°C, which makes it suitable for use in the preparation of buffer solutions at physiological pH levels. The optimum concentration of TMAF varies depending on the desired pH level and the presence of chloride ions. In cytosolic conditions, TMAF forms a complex withFormula:C4H12FNPurity:Min. 95%Molecular weight:93.14 g/mol





