CAS 373384-14-6
:[3-[(Dimethylamino)carbonyl]phenyl]-boronic acid
Description:
[3-[(Dimethylamino)carbonyl]phenyl]-boronic acid, with the CAS number 373384-14-6, is an organic compound that features a boronic acid functional group, which is characterized by the presence of a boron atom bonded to a hydroxyl group and an aryl group. This compound typically exhibits properties such as being a solid at room temperature and having moderate solubility in polar solvents due to the presence of the boronic acid moiety. The dimethylamino carbonyl substituent enhances its reactivity, making it useful in various chemical reactions, particularly in Suzuki coupling reactions, which are important for forming carbon-carbon bonds in organic synthesis. Additionally, the boronic acid group can participate in reversible covalent bonding with diols, making this compound valuable in the development of sensors and drug delivery systems. Its structural characteristics allow for potential applications in medicinal chemistry and materials science, particularly in the design of compounds that can interact with biological targets or serve as building blocks for more complex molecular architectures.
Formula:C9H12BNO3
InChI:InChI=1/C9H12BNO3/c1-11(2)9(12)7-4-3-5-8(6-7)10(13)14/h3-6,13-14H,1-2H3
SMILES:CN(C)C(=O)c1cccc(c1)B(O)O
Synonyms:- 3-(N,N-Dimethylaminocarbonyl)Phenylboronic Acid
- [3-(Dimethylcarbamoyl)Phenyl]Boronic Acid
- 3-(Dimethylcarbamoyl)Phenylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-(Dimethylcarbamoyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C9H12BNO3Purity:97.0 to 111.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:193.01(3-(Dimethylcarbamoyl)phenyl)boronic acid
CAS:(3-(Dimethylcarbamoyl)phenyl)boronic acidFormula:C9H12BNO3Purity:98%Molecular weight:193.013-(Dimethylcarbamoyl)phenylboronic acid
CAS:Formula:C9H12BNO3Purity:98%Color and Shape:SolidMolecular weight:193.00753-(Dimethylcarbamoyl)benzeneboronic acid
CAS:3-(Dimethylcarbamoyl)benzeneboronic acidFormula:C9H12BNO3Purity:98%Color and Shape:White SolidMolecular weight:193.00748N,N-Dimethylbenzamide-3-boronic acid
CAS:Formula:C9H12BNO3Purity:97%Color and Shape:Solid, PowderMolecular weight:193.01





