CymitQuimica logo

CAS 37399-09-0

:

tricyclo[3.2.1.0~2,4~]octane-3-carboxylic acid

Description:
Tricyclo[3.2.1.0^2,4]octane-3-carboxylic acid, with the CAS number 37399-09-0, is a bicyclic organic compound characterized by its unique tricyclic structure. This compound features a carboxylic acid functional group (-COOH) attached to a tricyclic framework, which contributes to its distinctive chemical properties. The presence of the carboxylic acid group makes it an acidic compound, capable of donating protons in solution. Its tricyclic structure imparts rigidity and influences its reactivity, making it a subject of interest in organic synthesis and materials science. The compound may exhibit interesting physical properties, such as solubility in polar solvents, and its stereochemistry can lead to varied interactions in biological systems. Additionally, due to its structural complexity, it may serve as a precursor or intermediate in the synthesis of more complex organic molecules. Overall, tricyclo[3.2.1.0^2,4]octane-3-carboxylic acid is notable for its unique architecture and potential applications in various chemical fields.
Formula:C9H12O2
InChI:InChI=1/C9H12O2/c10-9(11)8-6-4-1-2-5(3-4)7(6)8/h4-8H,1-3H2,(H,10,11)
InChI key:VKCZTBCHTNDVEK-MLVOBBTPSA-N
SMILES:C1CC2CC1C1C2C1C(=O)O
Found 3 products.