CAS 374538-03-1
:1-Methyl 2-boronobenzoate
Description:
1-Methyl 2-boronobenzoate, identified by its CAS number 374538-03-1, is an organic compound that features a boron atom bonded to a benzoate moiety. This compound typically exhibits characteristics common to boron-containing organic compounds, such as potential applications in organic synthesis and materials science. The presence of the methyl group enhances its solubility in organic solvents and may influence its reactivity. The boron atom can participate in various chemical reactions, including those involving nucleophiles, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the benzoate structure contributes to the compound's stability and may affect its electronic properties. Overall, 1-Methyl 2-boronobenzoate is of interest in fields such as medicinal chemistry and polymer science, where boron compounds are often utilized for their unique reactivity and ability to form stable complexes. As with any chemical substance, proper handling and safety precautions should be observed due to potential hazards associated with boron compounds.
Formula:C8H9BO4
InChI:InChI=1S/C8H9BO4/c1-13-8(10)6-4-2-3-5-7(6)9(11)12/h2-5,11-12H,1H3
InChI key:InChIKey=ODAXNYMENLFYMY-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(B(O)O)C=CC=C1
Synonyms:- 1-Methyl 2-boronobenzoate
- 2-(Methoxycarbonyl)Benzeneboronic Acid
- 2-(Methoxycarbonyl)Phenylboron
- 2-(Methoxycarbonyl)Phenylboronic Acid
- 2-Carbomethoxybenzeneboronicacid
- Benzoic acid, 2-borono-, 1-methyl ester
- Benzoic acid, 2-borono-, 1-methyl ester (9CI)
- Methyl 2-Boronobenzoate
- O-(Methoxycarbonyl)Phenylboronic Acid
- 2-Methoxycarbonylphenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-(Methoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H9BO4Purity:97.0 to 111.0 %Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:179.972-(Methoxycarbonyl)benzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H9BO4Purity:97%Color and Shape:White to cream to pale brown, Crystals or powder or crystalline powderMolecular weight:179.972-(Methoxycarbonyl)benzeneboronic acid
CAS:2-(Methoxycarbonyl)benzeneboronic acidFormula:C8H9BO4Purity:≥95%Color and Shape:SolidMolecular weight:179.965662-Methoxycarbonylphenylboronic acid
CAS:Formula:C8H9BO4Purity:98%Color and Shape:SolidMolecular weight:179.96572-Methoxycarbonylphenylboronic acid
CAS:Formula:C8H9BO4Purity:97%Color and Shape:SolidMolecular weight:179.972-Methoxycarbonylphenylboronic acid
CAS:Controlled ProductApplications 2-Methoxycarbonylphenylboronic acid
Formula:C8H9BO4Color and Shape:NeatMolecular weight:179.97






