CAS 37497-86-2
:4-Isoquinolinecarboxylic acid, 1-chloro-, methyl ester
Description:
4-Isoquinolinecarboxylic acid, 1-chloro-, methyl ester is an organic compound characterized by its isoquinoline structure, which features a bicyclic aromatic system. This compound contains a carboxylic acid functional group that has been esterified with methanol, resulting in a methyl ester. The presence of a chlorine atom at the 1-position of the isoquinoline ring introduces unique reactivity and influences its chemical properties. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have limited solubility in water due to their hydrophobic aromatic structure. The compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry. Additionally, derivatives of isoquinoline compounds are often studied for their biological activities, including potential pharmaceutical applications. Safety data should be consulted for handling, as halogenated compounds can pose specific health risks. Overall, 4-Isoquinolinecarboxylic acid, 1-chloro-, methyl ester is a versatile compound with potential applications in research and industry.
Formula:C11H8ClNO2
InChI:InChI=1S/C11H8ClNO2/c1-15-11(14)9-6-13-10(12)8-5-3-2-4-7(8)9/h2-6H,1H3
InChI key:InChIKey=YTJDBMFLRYQTPT-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C2=C(C(Cl)=NC1)C=CC=C2
Synonyms:- 1-Chloro-isoquinoline-4-carboxylic acid methyl ester
- Methyl 1-chloroisoquinoline-4-carboxylate
- 4-Isoquinolinecarboxylic acid, 1-chloro-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
METHYL 1-CHLORO-4-ISOQUINOLINECARBOXYLATE
CAS:Formula:C11H8ClNO2Purity:96%Color and Shape:SolidMolecular weight:221.6397Methyl 1-chloroisoquinoline-4-carboxylate
CAS:Methyl 1-chloroisoquinoline-4-carboxylateFormula:C11H8ClNO2Purity:96%Molecular weight:221.63972Methyl 1-chloroisoquinoline-4-carboxylate
CAS:Methyl 1-chloroisoquinoline-4-carboxylateFormula:C11H8ClNO2Purity:96%Molecular weight:221.641-Chloroisoquinoline-4-carboxylic acid methyl ester
CAS:Formula:C11H8ClNO2Purity:95%Color and Shape:SolidMolecular weight:221.641-Chloroisoquinoline-4-carboxylic acid methyl ester
CAS:1-Chloroisoquinoline-4-carboxylic acid methyl ester is a potent compound that acts as an antagonist of the prostanoid receptor. It blocks the binding of prostanoids to the receptor and inhibits the production of inflammatory molecules, such as leukotrienes. 1CIQME has been shown to have affinity for both Cox-1 and Cox-2, but is selective for Cox-2. This drug also competitively inhibits the enzyme cyclooxygenase (COX), which produces prostaglandins from arachidonic acid. 1CIQME has been shown to inhibit chemotaxis in mice and to block chemoattractant effects in human neutrophils.
Formula:C11H8ClNO2Purity:Min. 95%Molecular weight:221.64 g/mol




