CAS 375-73-5: Perfluorobutanesulfonic acid
Description:Perfluorobutanesulfonic acid (PFBS) is a synthetic perfluoroalkyl substance characterized by a fully fluorinated carbon chain of four carbons, with a sulfonic acid functional group. Its chemical formula is C4F9SO3H, and it is known for its high thermal stability and resistance to degradation, making it persistent in the environment. PFBS is a colorless liquid or solid at room temperature and is soluble in water, which contributes to its mobility in aquatic systems. It is used in various applications, including surfactants, coatings, and as a processing aid in the manufacture of fluoropolymers. Due to its structure, PFBS exhibits unique properties such as low surface tension and high surface activity. However, concerns have been raised regarding its environmental impact and potential health effects, as it can bioaccumulate and has been detected in water sources and living organisms. Regulatory agencies are increasingly scrutinizing PFBS and similar compounds due to their persistence and potential toxicity, leading to ongoing research into their effects on human health and ecosystems.
Formula:C4HF9O3S
InChI:InChI=1S/C4HF9O3S/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h(H,14,15,16)
InChI key:InChIKey=JGTNAGYHADQMCM-UHFFFAOYSA-N
SMILES:O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
- Synonyms:
- 1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonic acid
- 1,1,2,2,3,3,4,4,4-Nonafluorobutane-1-Sulfonic Acid
- 1,1,2,2,3,3,4,4,4-Nonafluorobutane-1-Sulfonic Acid Hydrate
- 1-Butanesulfonic acid, 1,1,2,2,3,3,4,4,4-nonafluoro-
- 1-Butanesulfonic acid, nonafluoro-
- 1-Perfluorobutanesulfonic acid
- Eftop FBSA
- Nonafluoro-1-butanesulfonic acid
- Nonafluorobutan-1-sulfonic acid
- Nonafluorobutane-1-sulfonic acid
- See more synonyms
- Nonafluorobutanesulfonic acid
- Perfluoro n-butylsulfonic acid
- Perfluorobutanesulfonic acid
- n-Nonafluorobutanesulfonic acid
